C11H16N2O — CID 82345735
2-ethyl-4-methyl-2,3-dihydro-1,4-benzoxazin-5-amine (PubChem CID 82345735) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-ethyl-4-methyl-2,3-dihydro-1,4-benzoxazin-5-amine.
| Compound Name | 2-ethyl-4-methyl-2,3-dihydro-1,4-benzoxazin-5-amine |
|---|---|
| PubChem CID | 82345735 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2-ethyl-4-methyl-2,3-dihydro-1,4-benzoxazin-5-amine |
| SMILES | CCC1CN(C)c2c(N)cccc2O1 |
| InChI | InChI=1S/C11H16N2O/c1-3-8-7-13(2)11-9(12)5-4-6-10(11)14-8/h4-6,8H,3,7,12H2,1-2H3 |
| InChIKey | KEXVMJIHVNJUEV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|