C12H19NS — CID 82366166
3-cyclohexyl-4,5-dimethylthiophen-2-amine (PubChem CID 82366166) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is 3-cyclohexyl-4,5-dimethylthiophen-2-amine.
| Compound Name | 3-cyclohexyl-4,5-dimethylthiophen-2-amine |
|---|---|
| PubChem CID | 82366166 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 3-cyclohexyl-4,5-dimethylthiophen-2-amine |
| SMILES | Cc1sc(N)c(C2CCCCC2)c1C |
| InChI | InChI=1S/C12H19NS/c1-8-9(2)14-12(13)11(8)10-6-4-3-5-7-10/h10H,3-7,13H2,1-2H3 |
| InChIKey | XMAGJDCCWXVBIS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |