C22H34N2 — CID 87526120
4,5-dicyclohexyl-2-methyl-6-prop-1-enylbenzene-1,3-diamine (PubChem CID 87526120) has the molecular formula C22H34N2 and a molecular weight of 326.53 g/mol. Its IUPAC name is 4,5-dicyclohexyl-2-methyl-6-prop-1-enylbenzene-1,3-diamine.
| Compound Name | 4,5-dicyclohexyl-2-methyl-6-prop-1-enylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 87526120 |
| Molecular Formula | C22H34N2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.27 |
| IUPAC Name | 4,5-dicyclohexyl-2-methyl-6-prop-1-enylbenzene-1,3-diamine |
| SMILES | CC=Cc1c(N)c(C)c(N)c(C2CCCCC2)c1C1CCCCC1 |
| InChI | InChI=1S/C22H34N2/c1-3-10-18-19(16-11-6-4-7-12-16)20(17-13-8-5-9-14-17)22(24)15(2)21(18)23/h3,10,16-17H,4-9,11-14,23-24H2,1-2H3 |
| InChIKey | MGJPFVNZMNDFIK-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|