About 4-bromofuro[3,2-c]pyridine-2-carbaldehyde
4-bromofuro[3,2-c]pyridine-2-carbaldehyde (PubChem CID 82391571) has the molecular formula C8H4BrNO2
and a molecular weight of 226.03 g/mol. Its IUPAC name is 4-bromofuro[3,2-c]pyridine-2-carbaldehyde.
Molecular Properties
| Compound Name | 4-bromofuro[3,2-c]pyridine-2-carbaldehyde |
| PubChem CID | 82391571 |
| Molecular Formula | C8H4BrNO2 |
| Molecular Weight | 226.03 g/mol |
| Exact Mass | 224.94 |
| IUPAC Name | 4-bromofuro[3,2-c]pyridine-2-carbaldehyde |
| SMILES | O=Cc1cc2c(Br)nccc2o1 |
| InChI | InChI=1S/C8H4BrNO2/c9-8-6-3-5(4-11)12-7(6)1-2-10-8/h1-4H |
| InChIKey | XDDKRCCXKHFZIJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.03 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-bromofuro[3,2-c]pyridine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromofuro[3,2-c]pyridine-2-carbaldehyde?
The IUPAC name of 4-bromofuro[3,2-c]pyridine-2-carbaldehyde (CID 82391571) is 4-bromofuro[3,2-c]pyridine-2-carbaldehyde.
What is the SMILES notation for 4-bromofuro[3,2-c]pyridine-2-carbaldehyde?
The canonical SMILES for 4-bromofuro[3,2-c]pyridine-2-carbaldehyde is O=Cc1cc2c(Br)nccc2o1.
What is the InChIKey of 4-bromofuro[3,2-c]pyridine-2-carbaldehyde?
The InChIKey is XDDKRCCXKHFZIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrNO2/c9-8-6-3-5(4-11)12-7(6)1-2-10-8/h1-4H.
What are the key properties of 4-bromofuro[3,2-c]pyridine-2-carbaldehyde?
4-bromofuro[3,2-c]pyridine-2-carbaldehyde has a molecular weight of 226.03 g/mol, XLogP of 2.40, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromofuro[3,2-c]pyridine-2-carbaldehyde is sourced from PubChem (CID 82391571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).