C10H15NS2 — CID 82394143
3-(thiophen-2-ylmethyl)thian-4-amine (PubChem CID 82394143) has the molecular formula C10H15NS2 and a molecular weight of 213.37 g/mol. Its IUPAC name is 3-(thiophen-2-ylmethyl)thian-4-amine.
| Compound Name | 3-(thiophen-2-ylmethyl)thian-4-amine |
|---|---|
| PubChem CID | 82394143 |
| Molecular Formula | C10H15NS2 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 3-(thiophen-2-ylmethyl)thian-4-amine |
| SMILES | NC1CCSCC1Cc1cccs1 |
| InChI | InChI=1S/C10H15NS2/c11-10-3-5-12-7-8(10)6-9-2-1-4-13-9/h1-2,4,8,10H,3,5-7,11H2 |
| InChIKey | RBRHNTOZYFHMCS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |