About 9H-pyrimido[4,5-b]indole-2-carboxylic acid
9H-pyrimido[4,5-b]indole-2-carboxylic acid (PubChem CID 82394262) has the molecular formula C11H7N3O2
and a molecular weight of 213.20 g/mol. Its IUPAC name is 9H-pyrimido[4,5-b]indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 9H-pyrimido[4,5-b]indole-2-carboxylic acid |
| PubChem CID | 82394262 |
| Molecular Formula | C11H7N3O2 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | 9H-pyrimido[4,5-b]indole-2-carboxylic acid |
| SMILES | O=C(O)c1ncc2c(n1)[nH]c1ccccc12 |
| InChI | InChI=1S/C11H7N3O2/c15-11(16)10-12-5-7-6-3-1-2-4-8(6)13-9(7)14-10/h1-5H,(H,15,16)(H,12,13,14) |
| InChIKey | AQQDTQXWZJVYTB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9H-pyrimido[4,5-b]indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-pyrimido[4,5-b]indole-2-carboxylic acid?
The IUPAC name of 9H-pyrimido[4,5-b]indole-2-carboxylic acid (CID 82394262) is 9H-pyrimido[4,5-b]indole-2-carboxylic acid.
What is the SMILES notation for 9H-pyrimido[4,5-b]indole-2-carboxylic acid?
The canonical SMILES for 9H-pyrimido[4,5-b]indole-2-carboxylic acid is O=C(O)c1ncc2c(n1)[nH]c1ccccc12.
What is the InChIKey of 9H-pyrimido[4,5-b]indole-2-carboxylic acid?
The InChIKey is AQQDTQXWZJVYTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3O2/c15-11(16)10-12-5-7-6-3-1-2-4-8(6)13-9(7)14-10/h1-5H,(H,15,16)(H,12,13,14).
What are the key properties of 9H-pyrimido[4,5-b]indole-2-carboxylic acid?
9H-pyrimido[4,5-b]indole-2-carboxylic acid has a molecular weight of 213.20 g/mol, XLogP of 1.81, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-pyrimido[4,5-b]indole-2-carboxylic acid is sourced from PubChem (CID 82394262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).