About 3-(3-methyl-1,2-thiazol-5-yl)oxetane-3-carboxylic acid
3-(3-methyl-1,2-thiazol-5-yl)oxetane-3-carboxylic acid (PubChem CID 82397881) has the molecular formula C8H9NO3S
and a molecular weight of 199.23 g/mol. Its IUPAC name is 3-(3-methyl-1,2-thiazol-5-yl)oxetane-3-carboxylic acid.
Analyze 3-(3-methyl-1,2-thiazol-5-yl)oxetane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methyl-1,2-thiazol-5-yl)oxetane-3-carboxylic acid?
The IUPAC name of 3-(3-methyl-1,2-thiazol-5-yl)oxetane-3-carboxylic acid (CID 82397881) is 3-(3-methyl-1,2-thiazol-5-yl)oxetane-3-carboxylic acid.
What is the SMILES notation for 3-(3-methyl-1,2-thiazol-5-yl)oxetane-3-carboxylic acid?
The canonical SMILES for 3-(3-methyl-1,2-thiazol-5-yl)oxetane-3-carboxylic acid is Cc1cc(C2(C(=O)O)COC2)sn1.
What is the InChIKey of 3-(3-methyl-1,2-thiazol-5-yl)oxetane-3-carboxylic acid?
The InChIKey is REQFETIPYVNGKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3S/c1-5-2-6(13-9-5)8(7(10)11)3-12-4-8/h2H,3-4H2,1H3,(H,10,11).
What are the key properties of 3-(3-methyl-1,2-thiazol-5-yl)oxetane-3-carboxylic acid?
3-(3-methyl-1,2-thiazol-5-yl)oxetane-3-carboxylic acid has a molecular weight of 199.23 g/mol, XLogP of 0.80, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methyl-1,2-thiazol-5-yl)oxetane-3-carboxylic acid is sourced from PubChem (CID 82397881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).