C9H8N4O2 — CID 824100
3-(furan-2-yl)-N-(1,2,4-triazol-4-yl)prop-2-enamide (PubChem CID 824100) has the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-(1,2,4-triazol-4-yl)prop-2-enamide.
| Compound Name | 3-(furan-2-yl)-N-(1,2,4-triazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 824100 |
| Molecular Formula | C9H8N4O2 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 3-(furan-2-yl)-N-(1,2,4-triazol-4-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccco1)Nn1cnnc1 |
| InChI | InChI=1S/C9H8N4O2/c14-9(12-13-6-10-11-7-13)4-3-8-2-1-5-15-8/h1-7H,(H,12,14) |
| InChIKey | MLWMVIHEPBAMTR-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|