C8H14N4OS — CID 82425218
2-(diethylamino)-1,3-thiazole-5-carbohydrazide (PubChem CID 82425218) has the molecular formula C8H14N4OS and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-(diethylamino)-1,3-thiazole-5-carbohydrazide.
| Compound Name | 2-(diethylamino)-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 82425218 |
| Molecular Formula | C8H14N4OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 2-(diethylamino)-1,3-thiazole-5-carbohydrazide |
| SMILES | CCN(CC)c1ncc(C(=O)NN)s1 |
| InChI | InChI=1S/C8H14N4OS/c1-3-12(4-2)8-10-5-6(14-8)7(13)11-9/h5H,3-4,9H2,1-2H3,(H,11,13) |
| InChIKey | GNSOYOFUCZNTFK-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|