C15H26N4S — CID 82457211
2-ethyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1H-pyrimidine-4-thione (PubChem CID 82457211) has the molecular formula C15H26N4S and a molecular weight of 294.47 g/mol. Its IUPAC name is 2-ethyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1H-pyrimidine-4-thione.
| Compound Name | 2-ethyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 82457211 |
| Molecular Formula | C15H26N4S |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 2-ethyl-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1H-pyrimidine-4-thione |
| SMILES | CCc1nc(=S)cc(NC2CC(C)(C)NC(C)(C)C2)[nH]1 |
| InChI | InChI=1S/C15H26N4S/c1-6-11-17-12(7-13(20)18-11)16-10-8-14(2,3)19-15(4,5)9-10/h7,10,19H,6,8-9H2,1-5H3,(H2,16,17,18,20) |
| InChIKey | HGQYKFBXNHNUNR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|