About 3-[(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)amino]propan-1-ol
3-[(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)amino]propan-1-ol (PubChem CID 82461101) has the molecular formula C10H14ClN3O
and a molecular weight of 227.69 g/mol. Its IUPAC name is 3-[(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)amino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)amino]propan-1-ol |
| PubChem CID | 82461101 |
| Molecular Formula | C10H14ClN3O |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 3-[(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)amino]propan-1-ol |
| SMILES | OCCCNc1nc(Cl)c2c(n1)CCC2 |
| InChI | InChI=1S/C10H14ClN3O/c11-9-7-3-1-4-8(7)13-10(14-9)12-5-2-6-15/h15H,1-6H2,(H,12,13,14) |
| InChIKey | YZHLCCFVBCHUAI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)amino]propan-1-ol?
The IUPAC name of 3-[(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)amino]propan-1-ol (CID 82461101) is 3-[(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)amino]propan-1-ol.
What is the SMILES notation for 3-[(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)amino]propan-1-ol?
The canonical SMILES for 3-[(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)amino]propan-1-ol is OCCCNc1nc(Cl)c2c(n1)CCC2.
What is the InChIKey of 3-[(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)amino]propan-1-ol?
The InChIKey is YZHLCCFVBCHUAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClN3O/c11-9-7-3-1-4-8(7)13-10(14-9)12-5-2-6-15/h15H,1-6H2,(H,12,13,14).
What are the key properties of 3-[(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)amino]propan-1-ol?
3-[(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)amino]propan-1-ol has a molecular weight of 227.69 g/mol, XLogP of 1.41, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-chloro-6,7-dihydro-5H-cyclopenta[d]pyrimidin-2-yl)amino]propan-1-ol is sourced from PubChem (CID 82461101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).