C14H18N2 — CID 82508927
(8-methyl-6,7,8,9-tetrahydro-5H-carbazol-1-yl)methanamine (PubChem CID 82508927) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is (8-methyl-6,7,8,9-tetrahydro-5H-carbazol-1-yl)methanamine.
| Compound Name | (8-methyl-6,7,8,9-tetrahydro-5H-carbazol-1-yl)methanamine |
|---|---|
| PubChem CID | 82508927 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | (8-methyl-6,7,8,9-tetrahydro-5H-carbazol-1-yl)methanamine |
| SMILES | CC1CCCc2c1[nH]c1c(CN)cccc21 |
| InChI | InChI=1S/C14H18N2/c1-9-4-2-6-11-12-7-3-5-10(8-15)14(12)16-13(9)11/h3,5,7,9,16H,2,4,6,8,15H2,1H3 |
| InChIKey | QFPVELJVAMULBX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |