C15H17NO2S2 — CID 82516545
1-(oxolan-2-ylmethyl)-3-(sulfanylmethyl)-6-thiophen-2-ylpyridin-2-one (PubChem CID 82516545) has the molecular formula C15H17NO2S2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 1-(oxolan-2-ylmethyl)-3-(sulfanylmethyl)-6-thiophen-2-ylpyridin-2-one.
| Compound Name | 1-(oxolan-2-ylmethyl)-3-(sulfanylmethyl)-6-thiophen-2-ylpyridin-2-one |
|---|---|
| PubChem CID | 82516545 |
| Molecular Formula | C15H17NO2S2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 1-(oxolan-2-ylmethyl)-3-(sulfanylmethyl)-6-thiophen-2-ylpyridin-2-one |
| SMILES | O=c1c(CS)ccc(-c2cccs2)n1CC1CCCO1 |
| InChI | InChI=1S/C15H17NO2S2/c17-15-11(10-19)5-6-13(14-4-2-8-20-14)16(15)9-12-3-1-7-18-12/h2,4-6,8,12,19H,1,3,7,9-10H2 |
| InChIKey | JGTBOFMENLKDQC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 31.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|