C10H12N2O2 — CID 82527497
3,4-dihydro-2H-1,5-benzodioxepine-4-carboximidamide (PubChem CID 82527497) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 3,4-dihydro-2H-1,5-benzodioxepine-4-carboximidamide.
| Compound Name | 3,4-dihydro-2H-1,5-benzodioxepine-4-carboximidamide |
|---|---|
| PubChem CID | 82527497 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 3,4-dihydro-2H-1,5-benzodioxepine-4-carboximidamide |
| SMILES | [H]/N=C(\N)C1CCOc2ccccc2O1 |
| InChI | InChI=1S/C10H12N2O2/c11-10(12)9-5-6-13-7-3-1-2-4-8(7)14-9/h1-4,9H,5-6H2,(H3,11,12) |
| InChIKey | YCPIGBQNULDLJC-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|