C11H16FN3 — CID 82581890
2-(2-aminoethyl)-7-fluoro-3,4-dihydro-1H-isoquinolin-5-amine (PubChem CID 82581890) has the molecular formula C11H16FN3 and a molecular weight of 209.27 g/mol. Its IUPAC name is 2-(2-aminoethyl)-7-fluoro-3,4-dihydro-1H-isoquinolin-5-amine.
| Compound Name | 2-(2-aminoethyl)-7-fluoro-3,4-dihydro-1H-isoquinolin-5-amine |
|---|---|
| PubChem CID | 82581890 |
| Molecular Formula | C11H16FN3 |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 2-(2-aminoethyl)-7-fluoro-3,4-dihydro-1H-isoquinolin-5-amine |
| SMILES | NCCN1CCc2c(N)cc(F)cc2C1 |
| InChI | InChI=1S/C11H16FN3/c12-9-5-8-7-15(4-2-13)3-1-10(8)11(14)6-9/h5-6H,1-4,7,13-14H2 |
| InChIKey | MEZWSVWMZHCYCU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|