C16H18N2O — CID 82582930
7-methoxy-N-phenyl-1,2,3,4-tetrahydroisoquinolin-8-amine (PubChem CID 82582930) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 7-methoxy-N-phenyl-1,2,3,4-tetrahydroisoquinolin-8-amine.
| Compound Name | 7-methoxy-N-phenyl-1,2,3,4-tetrahydroisoquinolin-8-amine |
|---|---|
| PubChem CID | 82582930 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 7-methoxy-N-phenyl-1,2,3,4-tetrahydroisoquinolin-8-amine |
| SMILES | COc1ccc2c(c1Nc1ccccc1)CNCC2 |
| InChI | InChI=1S/C16H18N2O/c1-19-15-8-7-12-9-10-17-11-14(12)16(15)18-13-5-3-2-4-6-13/h2-8,17-18H,9-11H2,1H3 |
| InChIKey | RAJVTJLGTXIJFR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |