C14H15NS — CID 82583431
5-methyl-8-thiophen-2-yl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 82583431) has the molecular formula C14H15NS and a molecular weight of 229.35 g/mol. Its IUPAC name is 5-methyl-8-thiophen-2-yl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 5-methyl-8-thiophen-2-yl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 82583431 |
| Molecular Formula | C14H15NS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 5-methyl-8-thiophen-2-yl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Cc1ccc(-c2cccs2)c2c1CCNC2 |
| InChI | InChI=1S/C14H15NS/c1-10-4-5-12(14-3-2-8-16-14)13-9-15-7-6-11(10)13/h2-5,8,15H,6-7,9H2,1H3 |
| InChIKey | XHYFOEHCZGKOHD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |