C16H26N4 — CID 82626186
N,N,1-trimethyl-3-(piperazin-1-ylmethyl)-2,3-dihydroindol-5-amine (PubChem CID 82626186) has the molecular formula C16H26N4 and a molecular weight of 274.41 g/mol. Its IUPAC name is N,N,1-trimethyl-3-(piperazin-1-ylmethyl)-2,3-dihydroindol-5-amine.
| Compound Name | N,N,1-trimethyl-3-(piperazin-1-ylmethyl)-2,3-dihydroindol-5-amine |
|---|---|
| PubChem CID | 82626186 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | N,N,1-trimethyl-3-(piperazin-1-ylmethyl)-2,3-dihydroindol-5-amine |
| SMILES | CN(C)c1ccc2c(c1)C(CN1CCNCC1)CN2C |
| InChI | InChI=1S/C16H26N4/c1-18(2)14-4-5-16-15(10-14)13(11-19(16)3)12-20-8-6-17-7-9-20/h4-5,10,13,17H,6-9,11-12H2,1-3H3 |
| InChIKey | SBBRFTOORCFBID-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|