C9H12N2O — CID 82652363
8-(aminomethyl)-2,3-dihydro-1H-indolizin-5-one (PubChem CID 82652363) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 8-(aminomethyl)-2,3-dihydro-1H-indolizin-5-one.
| Compound Name | 8-(aminomethyl)-2,3-dihydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 82652363 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 8-(aminomethyl)-2,3-dihydro-1H-indolizin-5-one |
| SMILES | NCc1ccc(=O)n2c1CCC2 |
| InChI | InChI=1S/C9H12N2O/c10-6-7-3-4-9(12)11-5-1-2-8(7)11/h3-4H,1-2,5-6,10H2 |
| InChIKey | UCSRJJLYTIRMSX-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |