C7H7F3N2O3S — CID 82712072
1-(5-nitrothiophen-3-yl)-N-(2,2,2-trifluoroethoxy)methanamine (PubChem CID 82712072) has the molecular formula C7H7F3N2O3S and a molecular weight of 256.20 g/mol. Its IUPAC name is 1-(5-nitrothiophen-3-yl)-N-(2,2,2-trifluoroethoxy)methanamine.
| Compound Name | 1-(5-nitrothiophen-3-yl)-N-(2,2,2-trifluoroethoxy)methanamine |
|---|---|
| PubChem CID | 82712072 |
| Molecular Formula | C7H7F3N2O3S |
| Molecular Weight | 256.20 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 1-(5-nitrothiophen-3-yl)-N-(2,2,2-trifluoroethoxy)methanamine |
| SMILES | O=[N+]([O-])c1cc(CNOCC(F)(F)F)cs1 |
| InChI | InChI=1S/C7H7F3N2O3S/c8-7(9,10)4-15-11-2-5-1-6(12(13)14)16-3-5/h1,3,11H,2,4H2 |
| InChIKey | LPCFLWGWIFXURW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.20 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|