C10H14F3N3O2S — CID 82811411
1-amino-N-[6-(trifluoromethyl)-3-pyridinyl]butane-2-sulfonamide (PubChem CID 82811411) has the molecular formula C10H14F3N3O2S and a molecular weight of 297.30 g/mol. Its IUPAC name is 1-amino-N-[6-(trifluoromethyl)-3-pyridinyl]butane-2-sulfonamide.
| Compound Name | 1-amino-N-[6-(trifluoromethyl)-3-pyridinyl]butane-2-sulfonamide |
|---|---|
| PubChem CID | 82811411 |
| Molecular Formula | C10H14F3N3O2S |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 1-amino-N-[6-(trifluoromethyl)-3-pyridinyl]butane-2-sulfonamide |
| SMILES | CCC(CN)S(=O)(=O)Nc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C10H14F3N3O2S/c1-2-8(5-14)19(17,18)16-7-3-4-9(15-6-7)10(11,12)13/h3-4,6,8,16H,2,5,14H2,1H3 |
| InChIKey | JCDXIMJAFOJCSG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |