C15H17F2NO2S — CID 82933653
2-cycloheptyl-2-(2,4-difluorophenyl)sulfonylacetonitrile (PubChem CID 82933653) has the molecular formula C15H17F2NO2S and a molecular weight of 313.37 g/mol. Its IUPAC name is 2-cycloheptyl-2-(2,4-difluorophenyl)sulfonylacetonitrile.
| Compound Name | 2-cycloheptyl-2-(2,4-difluorophenyl)sulfonylacetonitrile |
|---|---|
| PubChem CID | 82933653 |
| Molecular Formula | C15H17F2NO2S |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-cycloheptyl-2-(2,4-difluorophenyl)sulfonylacetonitrile |
| SMILES | N#CC(C1CCCCCC1)S(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H17F2NO2S/c16-12-7-8-14(13(17)9-12)21(19,20)15(10-18)11-5-3-1-2-4-6-11/h7-9,11,15H,1-6H2 |
| InChIKey | WJYGSWWUIGLFRK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |