C13H13F2NO2S — CID 82933692
2-cyclopentyl-2-(2,4-difluorophenyl)sulfonylacetonitrile (PubChem CID 82933692) has the molecular formula C13H13F2NO2S and a molecular weight of 285.31 g/mol. Its IUPAC name is 2-cyclopentyl-2-(2,4-difluorophenyl)sulfonylacetonitrile.
| Compound Name | 2-cyclopentyl-2-(2,4-difluorophenyl)sulfonylacetonitrile |
|---|---|
| PubChem CID | 82933692 |
| Molecular Formula | C13H13F2NO2S |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-cyclopentyl-2-(2,4-difluorophenyl)sulfonylacetonitrile |
| SMILES | N#CC(C1CCCC1)S(=O)(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H13F2NO2S/c14-10-5-6-12(11(15)7-10)19(17,18)13(8-16)9-3-1-2-4-9/h5-7,9,13H,1-4H2 |
| InChIKey | AWMHPUKURFYUSK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |