C10H11ClN2O5S2 — CID 82999678
2-[4-(methylcarbamoyl)-2-nitrophenyl]sulfanylethanesulfonyl chloride (PubChem CID 82999678) has the molecular formula C10H11ClN2O5S2 and a molecular weight of 338.79 g/mol. Its IUPAC name is 2-[4-(methylcarbamoyl)-2-nitrophenyl]sulfanylethanesulfonyl chloride.
| Compound Name | 2-[4-(methylcarbamoyl)-2-nitrophenyl]sulfanylethanesulfonyl chloride |
|---|---|
| PubChem CID | 82999678 |
| Molecular Formula | C10H11ClN2O5S2 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 2-[4-(methylcarbamoyl)-2-nitrophenyl]sulfanylethanesulfonyl chloride |
| SMILES | CNC(=O)c1ccc(SCCS(=O)(=O)Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H11ClN2O5S2/c1-12-10(14)7-2-3-9(8(6-7)13(15)16)19-4-5-20(11,17)18/h2-3,6H,4-5H2,1H3,(H,12,14) |
| InChIKey | BFYAXVCHAMNXPW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|