C8H13ClN4 — CID 83020276
2-(3-chloro-5,6-dimethylpyrazin-2-yl)-1,1-dimethylhydrazine (PubChem CID 83020276) has the molecular formula C8H13ClN4 and a molecular weight of 200.67 g/mol. Its IUPAC name is 2-(3-chloro-5,6-dimethylpyrazin-2-yl)-1,1-dimethylhydrazine.
| Compound Name | 2-(3-chloro-5,6-dimethylpyrazin-2-yl)-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 83020276 |
| Molecular Formula | C8H13ClN4 |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 2-(3-chloro-5,6-dimethylpyrazin-2-yl)-1,1-dimethylhydrazine |
| SMILES | Cc1nc(Cl)c(NN(C)C)nc1C |
| InChI | InChI=1S/C8H13ClN4/c1-5-6(2)11-8(7(9)10-5)12-13(3)4/h1-4H3,(H,11,12) |
| InChIKey | CDNJELKMHJVEMJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|