4-(2,2-dimethylhydrazinyl)-2,3-difluorobenzoic acid

C9H10F2N2O2 — CID 83026505

IUPAC4-(2,2-dimethylhydrazinyl)-2,3-difluorobenzoic acid
SMILESCN(C)Nc1ccc(C(=O)O)c(F)c1F
InChIInChI=1S/C9H10F2N2O2/c1-13(2)12-6-4-3-5(9(14)15)7(10)8(6)11/h3-4,12H,1-2H3,(H,14,15)
InChIKeyLGAWWKSKBZDZDC-UHFFFAOYSA-N
MW216.19 g/mol
LogP1.55
Rot. Bonds3

About 4-(2,2-dimethylhydrazinyl)-2,3-difluorobenzoic acid

4-(2,2-dimethylhydrazinyl)-2,3-difluorobenzoic acid (PubChem CID 83026505) has the molecular formula C9H10F2N2O2 and a molecular weight of 216.19 g/mol. Its IUPAC name is 4-(2,2-dimethylhydrazinyl)-2,3-difluorobenzoic acid.

Molecular Properties

Compound Name4-(2,2-dimethylhydrazinyl)-2,3-difluorobenzoic acid
PubChem CID83026505
Molecular FormulaC9H10F2N2O2
Molecular Weight216.19 g/mol
Exact Mass216.07
IUPAC Name4-(2,2-dimethylhydrazinyl)-2,3-difluorobenzoic acid
SMILESCN(C)Nc1ccc(C(=O)O)c(F)c1F
InChIInChI=1S/C9H10F2N2O2/c1-13(2)12-6-4-3-5(9(14)15)7(10)8(6)11/h3-4,12H,1-2H3,(H,14,15)
InChIKeyLGAWWKSKBZDZDC-UHFFFAOYSA-N
XLogP1.55
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.19
LogP ≤ 51.55
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 4-(2,2-dimethylhydrazinyl)-2,3-difluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,2-dimethylhydrazinyl)-2,3-difluorobenzoic acid?
The IUPAC name of 4-(2,2-dimethylhydrazinyl)-2,3-difluorobenzoic acid (CID 83026505) is 4-(2,2-dimethylhydrazinyl)-2,3-difluorobenzoic acid.
What is the SMILES notation for 4-(2,2-dimethylhydrazinyl)-2,3-difluorobenzoic acid?
The canonical SMILES for 4-(2,2-dimethylhydrazinyl)-2,3-difluorobenzoic acid is CN(C)Nc1ccc(C(=O)O)c(F)c1F.
What is the InChIKey of 4-(2,2-dimethylhydrazinyl)-2,3-difluorobenzoic acid?
The InChIKey is LGAWWKSKBZDZDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F2N2O2/c1-13(2)12-6-4-3-5(9(14)15)7(10)8(6)11/h3-4,12H,1-2H3,(H,14,15).
What are the key properties of 4-(2,2-dimethylhydrazinyl)-2,3-difluorobenzoic acid?
4-(2,2-dimethylhydrazinyl)-2,3-difluorobenzoic acid has a molecular weight of 216.19 g/mol, XLogP of 1.55, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-dimethylhydrazinyl)-2,3-difluorobenzoic acid is sourced from PubChem (CID 83026505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).