C9H18N8O — CID 83027648
6-hydrazinyl-2-N,2-N-dimethyl-4-N-morpholin-4-yl-1,3,5-triazine-2,4-diamine (PubChem CID 83027648) has the molecular formula C9H18N8O and a molecular weight of 254.30 g/mol. Its IUPAC name is 6-hydrazinyl-2-N,2-N-dimethyl-4-N-morpholin-4-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-hydrazinyl-2-N,2-N-dimethyl-4-N-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 83027648 |
| Molecular Formula | C9H18N8O |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 6-hydrazinyl-2-N,2-N-dimethyl-4-N-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(NN)nc(NN2CCOCC2)n1 |
| InChI | InChI=1S/C9H18N8O/c1-16(2)9-12-7(14-10)11-8(13-9)15-17-3-5-18-6-4-17/h3-6,10H2,1-2H3,(H2,11,12,13,14,15) |
| InChIKey | GSHMFXNHPKPJGQ-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|