C9H19N5 — CID 83032026
1-(cyclopropylmethyl)-3-(diaminomethylidene)-1-propan-2-ylguanidine (PubChem CID 83032026) has the molecular formula C9H19N5 and a molecular weight of 197.29 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-3-(diaminomethylidene)-1-propan-2-ylguanidine.
| Compound Name | 1-(cyclopropylmethyl)-3-(diaminomethylidene)-1-propan-2-ylguanidine |
|---|---|
| PubChem CID | 83032026 |
| Molecular Formula | C9H19N5 |
| Molecular Weight | 197.29 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | 1-(cyclopropylmethyl)-3-(diaminomethylidene)-1-propan-2-ylguanidine |
| SMILES | [H]/N=C(\N=C(N)N)N(CC1CC1)C(C)C |
| InChI | InChI=1S/C9H19N5/c1-6(2)14(5-7-3-4-7)9(12)13-8(10)11/h6-7H,3-5H2,1-2H3,(H5,10,11,12,13) |
| InChIKey | IDFVQQGHLHPDKI-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|