C14H33N5O4S — CID 86583226
2-[N,N-di(propan-2-yl)carbamimidoyl]-1,1-di(propan-2-yl)guanidine;sulfuric acid (PubChem CID 86583226) has the molecular formula C14H33N5O4S and a molecular weight of 367.52 g/mol. Its IUPAC name is 2-[N,N-di(propan-2-yl)carbamimidoyl]-1,1-di(propan-2-yl)guanidine;sulfuric acid.
| Compound Name | 2-[N,N-di(propan-2-yl)carbamimidoyl]-1,1-di(propan-2-yl)guanidine;sulfuric acid |
|---|---|
| PubChem CID | 86583226 |
| Molecular Formula | C14H33N5O4S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 2-[N,N-di(propan-2-yl)carbamimidoyl]-1,1-di(propan-2-yl)guanidine;sulfuric acid |
| SMILES | O=S(=O)(O)O.[H]/N=C(/N=C(N)N(C(C)C)C(C)C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C14H31N5.H2O4S/c1-9(2)18(10(3)4)13(15)17-14(16)19(11(5)6)12(7)8;1-5(2,3)4/h9-12H,1-8H3,(H3,15,16,17);(H2,1,2,3,4) |
| InChIKey | OSFPAJBFVIQVFO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 143.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|