C7H16N3Zn- — CID 175721747
[N,N-di(propan-2-yl)carbamimidoyl]azanide;zinc (PubChem CID 175721747) has the molecular formula C7H16N3Zn- and a molecular weight of 207.62 g/mol. Its IUPAC name is [N,N-di(propan-2-yl)carbamimidoyl]azanide;zinc.
| Compound Name | [N,N-di(propan-2-yl)carbamimidoyl]azanide;zinc |
|---|---|
| PubChem CID | 175721747 |
| Molecular Formula | C7H16N3Zn- |
| Molecular Weight | 207.62 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | [N,N-di(propan-2-yl)carbamimidoyl]azanide;zinc |
| SMILES | [H]/N=C(\[NH-])N(C(C)C)C(C)C.[Zn] |
| InChI | InChI=1S/C7H16N3.Zn/c1-5(2)10(6(3)4)7(8)9;/h5-6H,1-4H3,(H2-,8,9);/q-1; |
| InChIKey | MUQNOCJJVGGABT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 50.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.62 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|