C13H14ClF2N3O2 — CID 83073423
N-(2-chloro-4,6-difluorophenyl)-2-(1,4-diazepan-1-yl)-2-oxoacetamide (PubChem CID 83073423) has the molecular formula C13H14ClF2N3O2 and a molecular weight of 317.72 g/mol. Its IUPAC name is N-(2-chloro-4,6-difluorophenyl)-2-(1,4-diazepan-1-yl)-2-oxoacetamide.
| Compound Name | N-(2-chloro-4,6-difluorophenyl)-2-(1,4-diazepan-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 83073423 |
| Molecular Formula | C13H14ClF2N3O2 |
| Molecular Weight | 317.72 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | N-(2-chloro-4,6-difluorophenyl)-2-(1,4-diazepan-1-yl)-2-oxoacetamide |
| SMILES | O=C(Nc1c(F)cc(F)cc1Cl)C(=O)N1CCCNCC1 |
| InChI | InChI=1S/C13H14ClF2N3O2/c14-9-6-8(15)7-10(16)11(9)18-12(20)13(21)19-4-1-2-17-3-5-19/h6-7,17H,1-5H2,(H,18,20) |
| InChIKey | FEVSUNWSTVXCFE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.72 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|