C9H15BrN6S — CID 83083573
(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methyl N-(diaminomethylidene)carbamimidothioate (PubChem CID 83083573) has the molecular formula C9H15BrN6S and a molecular weight of 319.23 g/mol. Its IUPAC name is (4-bromo-1-ethyl-3-methylpyrazol-5-yl)methyl N-(diaminomethylidene)carbamimidothioate.
| Compound Name | (4-bromo-1-ethyl-3-methylpyrazol-5-yl)methyl N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 83083573 |
| Molecular Formula | C9H15BrN6S |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | (4-bromo-1-ethyl-3-methylpyrazol-5-yl)methyl N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCc1c(Br)c(C)nn1CC |
| InChI | InChI=1S/C9H15BrN6S/c1-3-16-6(7(10)5(2)15-16)4-17-9(13)14-8(11)12/h3-4H2,1-2H3,(H5,11,12,13,14) |
| InChIKey | LNGNLFDOMJFFJN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|