C16H27N3O2 — CID 83091200
ethyl 2-(cycloheptylamino)-2-(1,3-dimethylpyrazol-4-yl)acetate (PubChem CID 83091200) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is ethyl 2-(cycloheptylamino)-2-(1,3-dimethylpyrazol-4-yl)acetate.
| Compound Name | ethyl 2-(cycloheptylamino)-2-(1,3-dimethylpyrazol-4-yl)acetate |
|---|---|
| PubChem CID | 83091200 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | ethyl 2-(cycloheptylamino)-2-(1,3-dimethylpyrazol-4-yl)acetate |
| SMILES | CCOC(=O)C(NC1CCCCCC1)c1cn(C)nc1C |
| InChI | InChI=1S/C16H27N3O2/c1-4-21-16(20)15(14-11-19(3)18-12(14)2)17-13-9-7-5-6-8-10-13/h11,13,15,17H,4-10H2,1-3H3 |
| InChIKey | MAZBUURQIKIQJZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |