About (1S)-2-azido-1-(1,3-dimethylpyrazol-4-yl)ethanol
(1S)-2-azido-1-(1,3-dimethylpyrazol-4-yl)ethanol (PubChem CID 83092774) has the molecular formula C7H11N5O
and a molecular weight of 181.20 g/mol. Its IUPAC name is (1S)-2-azido-1-(1,3-dimethylpyrazol-4-yl)ethanol.
Molecular Properties
| Compound Name | (1S)-2-azido-1-(1,3-dimethylpyrazol-4-yl)ethanol |
| PubChem CID | 83092774 |
| Molecular Formula | C7H11N5O |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | (1S)-2-azido-1-(1,3-dimethylpyrazol-4-yl)ethanol |
| SMILES | Cc1nn(C)cc1[C@H](O)CN=[N+]=[N-] |
| InChI | InChI=1S/C7H11N5O/c1-5-6(4-12(2)10-5)7(13)3-9-11-8/h4,7,13H,3H2,1-2H3/t7-/m1/s1 |
| InChIKey | UIVMGWILUKWYQY-SSDOTTSWSA-N |
| XLogP | 1.07 |
| TPSA | 86.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (1S)-2-azido-1-(1,3-dimethylpyrazol-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-2-azido-1-(1,3-dimethylpyrazol-4-yl)ethanol?
The IUPAC name of (1S)-2-azido-1-(1,3-dimethylpyrazol-4-yl)ethanol (CID 83092774) is (1S)-2-azido-1-(1,3-dimethylpyrazol-4-yl)ethanol.
What is the SMILES notation for (1S)-2-azido-1-(1,3-dimethylpyrazol-4-yl)ethanol?
The canonical SMILES for (1S)-2-azido-1-(1,3-dimethylpyrazol-4-yl)ethanol is Cc1nn(C)cc1[C@H](O)CN=[N+]=[N-].
What is the InChIKey of (1S)-2-azido-1-(1,3-dimethylpyrazol-4-yl)ethanol?
The InChIKey is UIVMGWILUKWYQY-SSDOTTSWSA-N. The full InChI is InChI=1S/C7H11N5O/c1-5-6(4-12(2)10-5)7(13)3-9-11-8/h4,7,13H,3H2,1-2H3/t7-/m1/s1.
What are the key properties of (1S)-2-azido-1-(1,3-dimethylpyrazol-4-yl)ethanol?
(1S)-2-azido-1-(1,3-dimethylpyrazol-4-yl)ethanol has a molecular weight of 181.20 g/mol, XLogP of 1.07, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-2-azido-1-(1,3-dimethylpyrazol-4-yl)ethanol is sourced from PubChem (CID 83092774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).