About 1-amino-3a,4-dihydroimidazo[1,5-a]indol-3-one
1-amino-3a,4-dihydroimidazo[1,5-a]indol-3-one (PubChem CID 83137788) has the molecular formula C10H9N3O
and a molecular weight of 187.20 g/mol. Its IUPAC name is 1-amino-3a,4-dihydroimidazo[1,5-a]indol-3-one.
Molecular Properties
| Compound Name | 1-amino-3a,4-dihydroimidazo[1,5-a]indol-3-one |
| PubChem CID | 83137788 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 1-amino-3a,4-dihydroimidazo[1,5-a]indol-3-one |
| SMILES | NC1=NC(=O)C2Cc3ccccc3N12 |
| InChI | InChI=1S/C10H9N3O/c11-10-12-9(14)8-5-6-3-1-2-4-7(6)13(8)10/h1-4,8H,5H2,(H2,11,12,14) |
| InChIKey | PYBZITXHBCGBMS-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-amino-3a,4-dihydroimidazo[1,5-a]indol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3a,4-dihydroimidazo[1,5-a]indol-3-one?
The IUPAC name of 1-amino-3a,4-dihydroimidazo[1,5-a]indol-3-one (CID 83137788) is 1-amino-3a,4-dihydroimidazo[1,5-a]indol-3-one.
What is the SMILES notation for 1-amino-3a,4-dihydroimidazo[1,5-a]indol-3-one?
The canonical SMILES for 1-amino-3a,4-dihydroimidazo[1,5-a]indol-3-one is NC1=NC(=O)C2Cc3ccccc3N12.
What is the InChIKey of 1-amino-3a,4-dihydroimidazo[1,5-a]indol-3-one?
The InChIKey is PYBZITXHBCGBMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O/c11-10-12-9(14)8-5-6-3-1-2-4-7(6)13(8)10/h1-4,8H,5H2,(H2,11,12,14).
What are the key properties of 1-amino-3a,4-dihydroimidazo[1,5-a]indol-3-one?
1-amino-3a,4-dihydroimidazo[1,5-a]indol-3-one has a molecular weight of 187.20 g/mol, XLogP of 0.27, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3a,4-dihydroimidazo[1,5-a]indol-3-one is sourced from PubChem (CID 83137788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).