C12H24OS2 — CID 83161760
5-methyl-1-(3-methyl-1,4-dithian-2-yl)hexan-1-ol (PubChem CID 83161760) has the molecular formula C12H24OS2 and a molecular weight of 248.46 g/mol. Its IUPAC name is 5-methyl-1-(3-methyl-1,4-dithian-2-yl)hexan-1-ol.
| Compound Name | 5-methyl-1-(3-methyl-1,4-dithian-2-yl)hexan-1-ol |
|---|---|
| PubChem CID | 83161760 |
| Molecular Formula | C12H24OS2 |
| Molecular Weight | 248.46 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 5-methyl-1-(3-methyl-1,4-dithian-2-yl)hexan-1-ol |
| SMILES | CC(C)CCCC(O)C1SCCSC1C |
| InChI | InChI=1S/C12H24OS2/c1-9(2)5-4-6-11(13)12-10(3)14-7-8-15-12/h9-13H,4-8H2,1-3H3 |
| InChIKey | IBQWSXMKJVYRJG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |