C16H15N3O2S — CID 83282723
1-ethyl-5-(thiophene-2-carbonylamino)indole-2-carboxamide (PubChem CID 83282723) has the molecular formula C16H15N3O2S and a molecular weight of 313.38 g/mol. Its IUPAC name is 1-ethyl-5-(thiophene-2-carbonylamino)indole-2-carboxamide.
| Compound Name | 1-ethyl-5-(thiophene-2-carbonylamino)indole-2-carboxamide |
|---|---|
| PubChem CID | 83282723 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 1-ethyl-5-(thiophene-2-carbonylamino)indole-2-carboxamide |
| SMILES | CCn1c(C(N)=O)cc2cc(NC(=O)c3cccs3)ccc21 |
| InChI | InChI=1S/C16H15N3O2S/c1-2-19-12-6-5-11(8-10(12)9-13(19)15(17)20)18-16(21)14-4-3-7-22-14/h3-9H,2H2,1H3,(H2,17,20)(H,18,21) |
| InChIKey | JVFQEMWWKGEVEX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |