C11H16N2S — CID 83533343
2-(4-methylsulfanylphenyl)pyrrolidin-1-amine (PubChem CID 83533343) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is 2-(4-methylsulfanylphenyl)pyrrolidin-1-amine.
| Compound Name | 2-(4-methylsulfanylphenyl)pyrrolidin-1-amine |
|---|---|
| PubChem CID | 83533343 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-(4-methylsulfanylphenyl)pyrrolidin-1-amine |
| SMILES | CSc1ccc(C2CCCN2N)cc1 |
| InChI | InChI=1S/C11H16N2S/c1-14-10-6-4-9(5-7-10)11-3-2-8-13(11)12/h4-7,11H,2-3,8,12H2,1H3 |
| InChIKey | YJXWFZLUKLIJME-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|