C8H9BrN4S — CID 83664747
2-[3-(4-bromothiophen-2-yl)triazol-4-yl]ethanamine (PubChem CID 83664747) has the molecular formula C8H9BrN4S and a molecular weight of 273.16 g/mol. Its IUPAC name is 2-[3-(4-bromothiophen-2-yl)triazol-4-yl]ethanamine.
| Compound Name | 2-[3-(4-bromothiophen-2-yl)triazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 83664747 |
| Molecular Formula | C8H9BrN4S |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 271.97 |
| IUPAC Name | 2-[3-(4-bromothiophen-2-yl)triazol-4-yl]ethanamine |
| SMILES | NCCc1cnnn1-c1cc(Br)cs1 |
| InChI | InChI=1S/C8H9BrN4S/c9-6-3-8(14-5-6)13-7(1-2-10)4-11-12-13/h3-5H,1-2,10H2 |
| InChIKey | HWCAYORETUODGY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |