2-amino-4-(methylamino)-1,3-thiazole-5-carboxylic acid

C5H7N3O2S — CID 83695609

IUPAC2-amino-4-(methylamino)-1,3-thiazole-5-carboxylic acid
SMILESCNc1nc(N)sc1C(=O)O
InChIInChI=1S/C5H7N3O2S/c1-7-3-2(4(9)10)11-5(6)8-3/h7H,1H3,(H2,6,8)(H,9,10)
InChIKeyXVDQLSREAAYVTC-UHFFFAOYSA-N
MW173.20 g/mol
LogP0.47
Rot. Bonds2

About 2-amino-4-(methylamino)-1,3-thiazole-5-carboxylic acid

2-amino-4-(methylamino)-1,3-thiazole-5-carboxylic acid (PubChem CID 83695609) has the molecular formula C5H7N3O2S and a molecular weight of 173.20 g/mol. Its IUPAC name is 2-amino-4-(methylamino)-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-amino-4-(methylamino)-1,3-thiazole-5-carboxylic acid
PubChem CID83695609
Molecular FormulaC5H7N3O2S
Molecular Weight173.20 g/mol
Exact Mass173.03
IUPAC Name2-amino-4-(methylamino)-1,3-thiazole-5-carboxylic acid
SMILESCNc1nc(N)sc1C(=O)O
InChIInChI=1S/C5H7N3O2S/c1-7-3-2(4(9)10)11-5(6)8-3/h7H,1H3,(H2,6,8)(H,9,10)
InChIKeyXVDQLSREAAYVTC-UHFFFAOYSA-N
XLogP0.47
TPSA88.24 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.20
LogP ≤ 50.47
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze 2-amino-4-(methylamino)-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-4-(methylamino)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-amino-4-(methylamino)-1,3-thiazole-5-carboxylic acid (CID 83695609) is 2-amino-4-(methylamino)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-amino-4-(methylamino)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-amino-4-(methylamino)-1,3-thiazole-5-carboxylic acid is CNc1nc(N)sc1C(=O)O.
What is the InChIKey of 2-amino-4-(methylamino)-1,3-thiazole-5-carboxylic acid?
The InChIKey is XVDQLSREAAYVTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O2S/c1-7-3-2(4(9)10)11-5(6)8-3/h7H,1H3,(H2,6,8)(H,9,10).
What are the key properties of 2-amino-4-(methylamino)-1,3-thiazole-5-carboxylic acid?
2-amino-4-(methylamino)-1,3-thiazole-5-carboxylic acid has a molecular weight of 173.20 g/mol, XLogP of 0.47, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(methylamino)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 83695609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).