C5H3Cl3N2O2S — CID 82225663
2-amino-4-(trichloromethyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 82225663) has the molecular formula C5H3Cl3N2O2S and a molecular weight of 261.52 g/mol. Its IUPAC name is 2-amino-4-(trichloromethyl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-amino-4-(trichloromethyl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82225663 |
| Molecular Formula | C5H3Cl3N2O2S |
| Molecular Weight | 261.52 g/mol |
| Exact Mass | 259.90 |
| IUPAC Name | 2-amino-4-(trichloromethyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | Nc1nc(C(Cl)(Cl)Cl)c(C(=O)O)s1 |
| InChI | InChI=1S/C5H3Cl3N2O2S/c6-5(7,8)2-1(3(11)12)13-4(9)10-2/h(H2,9,10)(H,11,12) |
| InChIKey | MPGNKRDWVYEGIR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|