About [1]benzofuro[3,2-c][1,2]oxazol-3-ylmethanamine
[1]benzofuro[3,2-c][1,2]oxazol-3-ylmethanamine (PubChem CID 83847087) has the molecular formula C10H8N2O2
and a molecular weight of 188.19 g/mol. Its IUPAC name is [1]benzofuro[3,2-c][1,2]oxazol-3-ylmethanamine.
Molecular Properties
| Compound Name | [1]benzofuro[3,2-c][1,2]oxazol-3-ylmethanamine |
| PubChem CID | 83847087 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | [1]benzofuro[3,2-c][1,2]oxazol-3-ylmethanamine |
| SMILES | NCc1onc2c1oc1ccccc12 |
| InChI | InChI=1S/C10H8N2O2/c11-5-8-10-9(12-14-8)6-3-1-2-4-7(6)13-10/h1-4H,5,11H2 |
| InChIKey | OXIBKYQWNMRZCI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1]benzofuro[3,2-c][1,2]oxazol-3-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1]benzofuro[3,2-c][1,2]oxazol-3-ylmethanamine?
The IUPAC name of [1]benzofuro[3,2-c][1,2]oxazol-3-ylmethanamine (CID 83847087) is [1]benzofuro[3,2-c][1,2]oxazol-3-ylmethanamine.
What is the SMILES notation for [1]benzofuro[3,2-c][1,2]oxazol-3-ylmethanamine?
The canonical SMILES for [1]benzofuro[3,2-c][1,2]oxazol-3-ylmethanamine is NCc1onc2c1oc1ccccc12.
What is the InChIKey of [1]benzofuro[3,2-c][1,2]oxazol-3-ylmethanamine?
The InChIKey is OXIBKYQWNMRZCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2/c11-5-8-10-9(12-14-8)6-3-1-2-4-7(6)13-10/h1-4H,5,11H2.
What are the key properties of [1]benzofuro[3,2-c][1,2]oxazol-3-ylmethanamine?
[1]benzofuro[3,2-c][1,2]oxazol-3-ylmethanamine has a molecular weight of 188.19 g/mol, XLogP of 2.03, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1]benzofuro[3,2-c][1,2]oxazol-3-ylmethanamine is sourced from PubChem (CID 83847087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).