C9H13N3S — CID 83871510
4-(methylamino)-5,6,7,8-tetrahydro-1H-quinazoline-2-thione (PubChem CID 83871510) has the molecular formula C9H13N3S and a molecular weight of 195.29 g/mol. Its IUPAC name is 4-(methylamino)-5,6,7,8-tetrahydro-1H-quinazoline-2-thione.
| Compound Name | 4-(methylamino)-5,6,7,8-tetrahydro-1H-quinazoline-2-thione |
|---|---|
| PubChem CID | 83871510 |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 4-(methylamino)-5,6,7,8-tetrahydro-1H-quinazoline-2-thione |
| SMILES | CNc1nc(=S)[nH]c2c1CCCC2 |
| InChI | InChI=1S/C9H13N3S/c1-10-8-6-4-2-3-5-7(6)11-9(13)12-8/h2-5H2,1H3,(H2,10,11,12,13) |
| InChIKey | LWSCPYSSBSUZIR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|