C8H10N4O — CID 83874847
4-methoxy-5-methylpyrrolo[3,2-d]pyrimidin-2-amine (PubChem CID 83874847) has the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. Its IUPAC name is 4-methoxy-5-methylpyrrolo[3,2-d]pyrimidin-2-amine.
| Compound Name | 4-methoxy-5-methylpyrrolo[3,2-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 83874847 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 4-methoxy-5-methylpyrrolo[3,2-d]pyrimidin-2-amine |
| SMILES | COc1nc(N)nc2ccn(C)c12 |
| InChI | InChI=1S/C8H10N4O/c1-12-4-3-5-6(12)7(13-2)11-8(9)10-5/h3-4H,1-2H3,(H2,9,10,11) |
| InChIKey | NCHLGDQMPACVSR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |