C6H5N3O2S — CID 83876178
5-aminoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid (PubChem CID 83876178) has the molecular formula C6H5N3O2S and a molecular weight of 183.19 g/mol. Its IUPAC name is 5-aminoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid.
| Compound Name | 5-aminoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 83876178 |
| Molecular Formula | C6H5N3O2S |
| Molecular Weight | 183.19 g/mol |
| Exact Mass | 183.01 |
| IUPAC Name | 5-aminoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid |
| SMILES | Nc1c(C(=O)O)nc2sccn12 |
| InChI | InChI=1S/C6H5N3O2S/c7-4-3(5(10)11)8-6-9(4)1-2-12-6/h1-2H,7H2,(H,10,11) |
| InChIKey | DIWIWMABLLPRHK-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |