5-aminoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid

C6H5N3O2S — CID 83876178

IUPAC5-aminoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid
SMILESNc1c(C(=O)O)nc2sccn12
InChIInChI=1S/C6H5N3O2S/c7-4-3(5(10)11)8-6-9(4)1-2-12-6/h1-2H,7H2,(H,10,11)
InChIKeyDIWIWMABLLPRHK-UHFFFAOYSA-N
MW183.19 g/mol
LogP0.68
Rot. Bonds1

About 5-aminoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid

5-aminoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid (PubChem CID 83876178) has the molecular formula C6H5N3O2S and a molecular weight of 183.19 g/mol. Its IUPAC name is 5-aminoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid.

Molecular Properties

Compound Name5-aminoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid
PubChem CID83876178
Molecular FormulaC6H5N3O2S
Molecular Weight183.19 g/mol
Exact Mass183.01
IUPAC Name5-aminoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid
SMILESNc1c(C(=O)O)nc2sccn12
InChIInChI=1S/C6H5N3O2S/c7-4-3(5(10)11)8-6-9(4)1-2-12-6/h1-2H,7H2,(H,10,11)
InChIKeyDIWIWMABLLPRHK-UHFFFAOYSA-N
XLogP0.68
TPSA80.62 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.19
LogP ≤ 50.68
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 5-aminoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-aminoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid?
The IUPAC name of 5-aminoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid (CID 83876178) is 5-aminoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid.
What is the SMILES notation for 5-aminoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid?
The canonical SMILES for 5-aminoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid is Nc1c(C(=O)O)nc2sccn12.
What is the InChIKey of 5-aminoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid?
The InChIKey is DIWIWMABLLPRHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O2S/c7-4-3(5(10)11)8-6-9(4)1-2-12-6/h1-2H,7H2,(H,10,11).
What are the key properties of 5-aminoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid?
5-aminoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid has a molecular weight of 183.19 g/mol, XLogP of 0.68, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminoimidazo[2,1-b][1,3]thiazole-6-carboxylic acid is sourced from PubChem (CID 83876178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).