C12H15N3 — CID 83881015
N-cyclopropyl-3-ethylimidazo[1,5-a]pyridin-8-amine (PubChem CID 83881015) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is N-cyclopropyl-3-ethylimidazo[1,5-a]pyridin-8-amine.
| Compound Name | N-cyclopropyl-3-ethylimidazo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 83881015 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | N-cyclopropyl-3-ethylimidazo[1,5-a]pyridin-8-amine |
| SMILES | CCc1ncc2c(NC3CC3)cccn12 |
| InChI | InChI=1S/C12H15N3/c1-2-12-13-8-11-10(14-9-5-6-9)4-3-7-15(11)12/h3-4,7-9,14H,2,5-6H2,1H3 |
| InChIKey | WQSPQDODIBPODB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |