C11H16N4 — CID 83882052
3-methyl-2-pyrazolo[1,5-a]pyrimidin-2-ylbutan-1-amine (PubChem CID 83882052) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 3-methyl-2-pyrazolo[1,5-a]pyrimidin-2-ylbutan-1-amine.
| Compound Name | 3-methyl-2-pyrazolo[1,5-a]pyrimidin-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 83882052 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 3-methyl-2-pyrazolo[1,5-a]pyrimidin-2-ylbutan-1-amine |
| SMILES | CC(C)C(CN)c1cc2ncccn2n1 |
| InChI | InChI=1S/C11H16N4/c1-8(2)9(7-12)10-6-11-13-4-3-5-15(11)14-10/h3-6,8-9H,7,12H2,1-2H3 |
| InChIKey | DEUNEFJGZYBJKZ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |