C9H10N4O2 — CID 83882716
4-imidazo[2,1-c][1,2,4]triazin-6-ylbutanoic acid (PubChem CID 83882716) has the molecular formula C9H10N4O2 and a molecular weight of 206.21 g/mol. Its IUPAC name is 4-imidazo[2,1-c][1,2,4]triazin-6-ylbutanoic acid.
| Compound Name | 4-imidazo[2,1-c][1,2,4]triazin-6-ylbutanoic acid |
|---|---|
| PubChem CID | 83882716 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 4-imidazo[2,1-c][1,2,4]triazin-6-ylbutanoic acid |
| SMILES | O=C(O)CCCc1cnc2nnccn12 |
| InChI | InChI=1S/C9H10N4O2/c14-8(15)3-1-2-7-6-10-9-12-11-4-5-13(7)9/h4-6H,1-3H2,(H,14,15) |
| InChIKey | VJJPAHNWSLQHBP-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |