C12H13BrN2 — CID 83902348
5-bromo-9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole (PubChem CID 83902348) has the molecular formula C12H13BrN2 and a molecular weight of 265.15 g/mol. Its IUPAC name is 5-bromo-9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole.
| Compound Name | 5-bromo-9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 83902348 |
| Molecular Formula | C12H13BrN2 |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 5-bromo-9-methyl-1,2,3,4-tetrahydropyrido[3,4-b]indole |
| SMILES | Cn1c2c(c3c(Br)cccc31)CCNC2 |
| InChI | InChI=1S/C12H13BrN2/c1-15-10-4-2-3-9(13)12(10)8-5-6-14-7-11(8)15/h2-4,14H,5-7H2,1H3 |
| InChIKey | BYBFAUNYQPOPMC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |