C13H16N2 — CID 83880773
5,9-dimethyl-1,2,3,4-tetrahydropyrido[4,3-b]indole (PubChem CID 83880773) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 5,9-dimethyl-1,2,3,4-tetrahydropyrido[4,3-b]indole.
| Compound Name | 5,9-dimethyl-1,2,3,4-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 83880773 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 5,9-dimethyl-1,2,3,4-tetrahydropyrido[4,3-b]indole |
| SMILES | Cc1cccc2c1c1c(n2C)CCNC1 |
| InChI | InChI=1S/C13H16N2/c1-9-4-3-5-12-13(9)10-8-14-7-6-11(10)15(12)2/h3-5,14H,6-8H2,1-2H3 |
| InChIKey | WLUVHZNYKBKICQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |